CAS 70901-15-4: α-Propyl-1H-pyrrole-1-acetic acid

Description:α-Propyl-1H-pyrrole-1-acetic acid, with the CAS number 70901-15-4, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a propyl group and an acetic acid moiety, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the pyrrole ring can engage in electrophilic substitution reactions due to its electron-rich nature. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility in organic solvents and moderate stability under standard conditions are also notable characteristics. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula:C₉H₁₃NO₂

InChI:InChI=1S/C9H13NO2/c1-2-5-8(9(11)12)10-6-3-4-7-10/h3-4,6-8H,2,5H2,1H3,(H,11,12)

InChI key:InChIKey=BZLPDTIGSUYXES-UHFFFAOYSA-N

SMILES:O=C(O)C(N1C=CC=C1)CCC

Synonyms:
1H-pyrrole-1-acetic acid, α-propyl-
2-Pyrrol-1-yl-pentanoic acid
2-Pyrrol-1-ylpentanoic acid
α-Propyl-1H-pyrrole-1-acetic acid
2-(1H-Pyrrol-1-yl)pentanoic acid

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	1H-pyrrole-1-acetic acid, α-propyl- REF: IN-DA00FD0RCAS: 70901-15-4	- - -	To inquire	Tue 12 Aug 25
	2-(1H-Pyrrol-1-yl)pentanoic acid REF: 3D-FP122043CAS: 70901-15-4	Min. 95%	- - -	Discontinued product