CAS 70901-63-2
:(6E,10E)-7,11,15-trimethyl-3-methylidenehexadeca-1,6,10,14-tetraene
Description:
The chemical substance known as (6E,10E)-7,11,15-trimethyl-3-methylidenehexadeca-1,6,10,14-tetraene, with the CAS number 70901-63-2, is a type of polyunsaturated hydrocarbon. It features a long carbon chain with multiple double bonds, specifically in the E configuration, which indicates the trans arrangement of substituents around the double bonds. This compound is characterized by its significant degree of unsaturation, which contributes to its reactivity and potential applications in organic synthesis and materials science. The presence of multiple methyl groups enhances its hydrophobic nature, making it less soluble in polar solvents. Additionally, the structure suggests potential biological activity, as many polyunsaturated compounds are known to play roles in various biochemical processes. Its unique configuration and functional groups may also influence its physical properties, such as melting and boiling points, as well as its stability under different environmental conditions. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemistry.
Formula:C20H32
InChI:InChI=1/C20H32/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h7,11,14-15H,1,4,8-10,12-13,16H2,2-3,5-6H3/b19-15+,20-14+
Synonyms:- (6E,10E)-7,11,15-Trimethyl-3-methylene-1,6,10,14-hexadecatetraene
- 1,6,10,14-hexadecatetraene, 7,11,15-trimethyl-3-methylene-, (6E,10E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
