
CAS 709031-30-1
:α-Amino-3-hydroxytricyclo[3.3.1.13,7]decane-1-acetic acid
Description:
α-Amino-3-hydroxytricyclo[3.3.1.13,7]decane-1-acetic acid, with the CAS number 709031-30-1, is a bicyclic compound characterized by its unique tricyclic structure, which contributes to its distinct chemical properties. This compound features an amino group and a hydroxyl group, which are indicative of its classification as an amino acid derivative. The presence of the tricyclic framework imparts rigidity to the molecule, influencing its conformational behavior and potential interactions with biological systems. The hydroxyl group enhances its solubility in polar solvents, while the amino group allows for participation in hydrogen bonding and potential reactivity in various chemical environments. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of novel therapeutic agents. Its structural complexity and functional groups suggest potential applications in medicinal chemistry, where modifications could lead to derivatives with enhanced efficacy or selectivity. Overall, α-Amino-3-hydroxytricyclo[3.3.1.13,7]decane-1-acetic acid represents a fascinating subject for further study in both synthetic and biological chemistry.
Formula:C12H19NO3
InChI:InChI=1S/C12H19NO3/c13-9(10(14)15)11-2-7-1-8(3-11)5-12(16,4-7)6-11/h7-9,16H,1-6,13H2,(H,14,15)
InChI key:InChIKey=ZOFWFAZCJJJYCE-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N)C12CC3(O)CC(C1)CC(C2)C3
Synonyms:- Tricyclo[3.3.1.13,7]decane-1-acetic acid, α-amino-3-hydroxy-
- 2-Amino-2-(3-hydroxyadamantan-1-yl)acetic acid
- α-Amino-3-hydroxytricyclo[3.3.1.13,7]decane-1-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.