CAS 70916-98-2

4'-formylbiphenyl-4-carboxylic acid

Description:

4'-Formylbiphenyl-4-carboxylic acid, identified by its CAS number 70916-98-2, is an organic compound characterized by the presence of both an aldehyde and a carboxylic acid functional group attached to a biphenyl structure. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents, while being less soluble in non-polar solvents. The presence of the formyl group (-CHO) and the carboxylic acid group (-COOH) contributes to its reactivity, allowing it to participate in various chemical reactions such as condensation and esterification. Additionally, the biphenyl backbone provides a degree of rigidity and planarity, which can influence its physical properties and interactions. This compound may find applications in organic synthesis, materials science, and as a building block in the development of pharmaceuticals or agrochemicals. Its specific reactivity and applications would depend on the functional groups and the overall molecular structure, making it a versatile compound in chemical research.

Formula: C₁₄H₁₀O₃

InChI: InChI=1/C14H10O3/c15-9-10-1-3-11(4-2-10)12-5-7-13(8-6-12)14(16)17/h1-9H,(H,16,17)

SMILES: c1cc(ccc1C=O)c1ccc(cc1)C(=O)O

Synonyms:

• [1,1'-Biphenyl]-4-carboxylic acid, 4'-formyl-
• 4'-Formyl-1,1'-Biphenyl-4-Carboxylic Acid

4-(4-Formylphenyl)benzoic acid

CAS: 70916-98-2

Formula: C₁₄H₁₀O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 226.2274

Ref: IN-DA00FAKL

4'-Formyl[1,1'-biphenyl]-4-carboxylic acid

CAS: 70916-98-2

4'-Formyl[1,1'-biphenyl]-4-carboxylic acid

Formula: C₁₄H₁₀O₃

Purity: 97%

Color and Shape: grey solid

Molecular weight: 226.23g/mol

Ref: 54-OR7391

4′-Formylbiphenyl-4-carboxylic acid

CAS: 70916-98-2

Formula: C₁₄H₁₀O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 226.231

Ref: 10-F014267

4-(4-formylphenyl)benzoic acid

CAS: 70916-98-2

4-Formylphenyl benzoic acid is a functional group that can be found in solvents and meaningful solutes. It has the ability to analyze proton and metal ions, as well as being synthetically made from zeolites. This type of ligand is often used for catalysis and inorganic frameworks. It also interacts with organic ligands.

Formula: C₁₄H₁₀O₃

Purity: Min. 95%

Molecular weight: 226.2 g/mol

Ref: 3D-VCA91698