CAS 70921-63-0
:glycylglycyl-L-lysyl-N~5~-(diaminomethylidene)-L-ornithine
Description:
Glycylglycyl-L-lysyl-N~5~-(diaminomethylidene)-L-ornithine, with the CAS number 70921-63-0, is a synthetic peptide that features a complex structure comprising multiple amino acids. This compound is characterized by the presence of lysine and ornithine, which are basic amino acids, contributing to its potential biological activity. The diaminomethylidene group enhances its reactivity and may influence its interaction with biological targets. As a peptide, it is likely to exhibit properties such as solubility in water, depending on the pH and the presence of other ions. Its structure suggests potential applications in biochemistry and pharmacology, particularly in the development of therapeutics or as a research tool in studying protein interactions and cellular processes. The presence of multiple amino acid residues may also confer stability and specificity in biological systems. However, detailed studies would be necessary to fully elucidate its properties, biological activity, and potential applications.
Formula:C16H32N8O5
InChI:InChI=1/C16H32N8O5/c17-6-2-1-4-10(23-13(26)9-22-12(25)8-18)14(27)24-11(15(28)29)5-3-7-21-16(19)20/h10-11H,1-9,17-18H2,(H,22,25)(H,23,26)(H,24,27)(H,28,29)(H4,19,20,21)/t10-,11-/m0/s1
SMILES:C(CCN)C[C@@H](C(=N[C@@H](CCCNC(=N)N)C(=O)O)O)N=C(CN=C(CN)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
H-Gly-Gly-Lys-Arg-OH acetate salt
CAS:The H-Gly-Gly-Lys-Arg-OH acetate salt is a diagnostic agent that belongs to the group of active analogues. It is an analogue of sialin, a compound that has been shown to be involved in the molecular pathogenesis of cancer tissues. Sialic acid is an important component of many glycoproteins and glycolipids found in the human body. This compound is metabolized by sialidase enzymes, which are present in various tissues and organs such as the brain, kidney, liver, and plasma. The H-Gly-Gly-Lys-Arg-OH acetate salt inhibits these enzymes by binding to them and preventing their action. This drug also inhibits ATP dependent transport systems for neuronal cells.
Formula:C16H32N8O5Purity:Min. 95%Molecular weight:416.48 g/mol
