CAS 70922-35-9
:N-(2-piperidin-4-ylethyl)acetamide
Description:
N-(2-piperidin-4-ylethyl)acetamide, identified by its CAS number 70922-35-9, is an organic compound characterized by its amide functional group, which is derived from acetic acid and a piperidine moiety. This compound features a piperidine ring substituted with an ethyl group, contributing to its structural complexity and potential biological activity. Typically, such compounds exhibit moderate to high solubility in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. The piperidine ring may impart certain pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, its stability and reactivity can be influenced by the presence of the piperidine nitrogen, which can participate in various chemical reactions. Overall, N-(2-piperidin-4-ylethyl)acetamide represents a class of compounds that may have significant implications in drug design and development.
Formula:C9H18N2O
InChI:InChI=1/C9H18N2O/c1-8(12)11-7-4-9-2-5-10-6-3-9/h9-10H,2-7H2,1H3,(H,11,12)
SMILES:CC(=NCCC1CCNCC1)O
Synonyms:- acetamide, N-[2-(4-piperidinyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.