CAS 7093-10-9
:1,2-dihydrocyclopenta[no]tetraphene
Description:
1,2-Dihydrocyclopenta[no]tetraphene, with the CAS number 7093-10-9, is a polycyclic aromatic hydrocarbon characterized by its unique fused ring structure. This compound features a cyclopenta ring fused to a tetracene-like framework, which contributes to its distinct electronic properties. It is typically a solid at room temperature and exhibits a high degree of stability due to its conjugated system, which allows for delocalization of π-electrons. The compound is known for its potential applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics, owing to its favorable charge transport properties. Additionally, 1,2-dihydrocyclopenta[no]tetraphene may exhibit fluorescence, making it of interest in photonic applications. Its synthesis often involves complex organic reactions, and it may require careful handling due to potential toxicity associated with polycyclic aromatic hydrocarbons. Overall, this compound represents a fascinating area of study within organic chemistry and materials science.
Formula:C20H14
InChI:InChI=1/C20H14/c1-2-7-17-13(4-1)8-9-16-12-15-6-3-5-14-10-11-18(19(14)15)20(16)17/h1-9,12H,10-11H2
SMILES:c1ccc2c(c1)ccc1cc3cccc4CCc(c34)c21
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.