CAS 7093-88-1
:2,5-dihydrofuran-2,5-diyl diacetate
Description:
2,5-Dihydrofuran-2,5-diyl diacetate, with the CAS number 7093-88-1, is an organic compound characterized by its diacetate functional groups attached to a dihydrofuran ring. This compound features a five-membered cyclic ether structure, which contributes to its unique chemical properties. The presence of two acetate groups enhances its reactivity and solubility in various organic solvents, making it useful in synthetic organic chemistry. Typically, it exhibits moderate stability under standard conditions but may undergo hydrolysis in the presence of water or strong bases, leading to the release of acetic acid and the formation of the corresponding diol. Its molecular structure allows for potential applications in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as boiling point and melting point, can vary based on purity and environmental conditions. Overall, 2,5-dihydrofuran-2,5-diyl diacetate serves as a valuable intermediate in organic synthesis due to its functional versatility.
Formula:C8H10O5
InChI:InChI=1/C8H10O5/c1-5(9)11-7-3-4-8(13-7)12-6(2)10/h3-4,7-8H,1-2H3
SMILES:CC(=O)OC1C=CC(OC(=O)C)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,5-Diacetoxy-2,5-dihydrofuran (Mixture of Isomers) (>90%)
CAS:Controlled ProductApplications 2,5-Diacetoxy-2,5-dihydrofuran is used as a reagent to synthesize Mexicanin H, a biologically active sesquiterpene lactone that exhibits antiparasitic activity against Trypanosoma cruzi (a parasite that causes Chagas disease)
References Jimenez-Ortiz, V., et al.: Parasitology, 91, 170 (2005); Romo, J., et al.: Tetrahedron Lett., No vol. given, 1029 (1966)Formula:C8H10O5Purity:>90%Color and Shape:NeatMolecular weight:186.16

