CymitQuimica logo

CAS 70933-58-3

:

Acetamide, N-(3-ethynylphenyl)-

Description:
Acetamide, N-(3-ethynylphenyl)-, also known by its CAS number 70933-58-3, is an organic compound characterized by the presence of an acetamide functional group attached to a 3-ethynylphenyl moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its aromatic structure. The ethynyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, including coupling reactions and polymer synthesis. The presence of the amide functional group suggests that it may participate in hydrogen bonding, influencing its physical properties such as melting point and solubility. Additionally, compounds like this may have applications in pharmaceuticals, agrochemicals, or materials science due to their unique structural features. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, N-(3-ethynylphenyl)acetamide represents a versatile compound in organic chemistry with potential utility in various fields.
Formula:C10H9NO
InChI:InChI=1S/C10H9NO/c1-3-9-5-4-6-10(7-9)11-8(2)12/h1,4-7H,2H3,(H,11,12)
InChI key:KPCKMWGCLHYFCN-UHFFFAOYSA-N
SMILES:CC(=O)NC1=CC=CC(=C1)C#C
Found 4 products.