CAS 70935-15-8

methyl (3Z)-4-(2,5-dimethoxyphenyl)-4-hydroxy-2-oxobut-3-enoate

Description:

Methyl (3Z)-4-(2,5-dimethoxyphenyl)-4-hydroxy-2-oxobut-3-enoate, with the CAS number 70935-15-8, is an organic compound characterized by its complex structure, which includes a methyl ester functional group, a hydroxy group, and a conjugated enone system. The presence of the 2,5-dimethoxyphenyl group contributes to its aromatic characteristics and may influence its reactivity and solubility. This compound is likely to exhibit properties typical of both esters and phenolic compounds, such as moderate polarity and potential for hydrogen bonding due to the hydroxy group. Its structural features suggest potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit biological activity, which is common for molecules with similar structural motifs. However, specific data regarding its physical properties, such as melting point, boiling point, and solubility, would require empirical measurement or literature reference for precise characterization.

Formula: C₁₃H₁₄O₆

InChI: InChI=1/C13H14O6/c1-17-8-4-5-12(18-2)9(6-8)10(14)7-11(15)13(16)19-3/h4-7,14H,1-3H3/b10-7-

SMILES: COc1ccc(c(c1)/C(=C/C(=O)C(=O)OC)/O)OC

Methyl 4-(2,5-dimethoxyphenyl)-2,4-dioxobutanoate

CAS: 70935-15-8

Versatile small molecule scaffold

Formula: C₁₃H₁₄O₆

Purity: Min. 95%

Molecular weight: 266.25 g/mol

Ref: 3D-VCA93515