CAS 70946-43-9

2-Furanacetic acid, α-amino-, methyl ester

Description:

2-Furanacetic acid, α-amino-, methyl ester, also known as methyl 2-furylglycinate, is an organic compound characterized by its furan ring structure and an amino acid derivative. This compound features a furan ring, which contributes to its aromatic properties, and a carboxylic acid group that is esterified with a methyl group, enhancing its solubility in organic solvents. The presence of the amino group indicates that it can participate in various biochemical reactions, making it relevant in pharmaceutical and biochemical applications. It is typically a white to off-white solid, and its molecular structure allows for potential interactions with biological systems, including enzyme activity and receptor binding. The compound may exhibit moderate polarity due to the combination of the furan ring and the ester functional group, influencing its reactivity and solubility. As with many amino acid derivatives, it may also display properties such as chirality, which can affect its biological activity. Overall, 2-Furanacetic acid, α-amino-, methyl ester is of interest in both synthetic organic chemistry and medicinal chemistry.

Formula: C₇H₉NO₃

InChI: InChI=1S/C7H9NO3/c1-10-7(9)6(8)5-3-2-4-11-5/h2-4,6H,8H2,1H3

InChI key: InChIKey=FEHASYZONKCPOM-UHFFFAOYSA-N

SMILES: C(C(OC)=O)(N)C1=CC=CO1

Synonyms:

• Methyl 2-amino-2-(2-furyl)acetate
• 2-Furanacetic acid, α-amino-, methyl ester, (±)-
• Methyl α-amino-2-furanacetate
• 2-Furanacetic acid, α-amino-, methyl ester