CAS 70951-95-0

4-Bromo-3-ethyl-5-nitro-1H-pyrazole

Description:

4-Bromo-3-ethyl-5-nitro-1H-pyrazole is a heterocyclic organic compound characterized by its pyrazole ring, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position, an ethyl group at the 3-position, and a nitro group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and crystalline form. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The nitro group enhances its reactivity, making it a useful building block in organic synthesis. Additionally, the bromine substituent can participate in further chemical reactions, such as nucleophilic substitutions. Safety data should be consulted, as compounds containing bromine and nitro groups can pose health risks and require careful handling. Overall, 4-Bromo-3-ethyl-5-nitro-1H-pyrazole is a versatile compound with significant relevance in chemical research and development.

Formula: C₅H₆BrN₃O₂

InChI: InChI=1S/C5H6BrN3O2/c1-2-3-4(6)5(8-7-3)9(10)11/h2H2,1H3,(H,7,8)

InChI key: InChIKey=VHCWZRAQQPVKSE-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(Br)C(CC)=NN1

Synonyms:

• 4-Bromo-3-ethyl-5-nitro-1H-pyrazole
• 4-Bromo-3-ethyl-5-nitropyrazole
• 1H-Pyrazole, 4-bromo-3-ethyl-5-nitro-