
CAS 70955-02-1
:N-2-Naphthalenylglycine hydrazide
Description:
N-2-Naphthalenylglycine hydrazide, with the CAS number 70955-02-1, is a chemical compound characterized by its unique structure, which includes a naphthalene moiety linked to a glycine hydrazide. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydrazide functional group. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The presence of the naphthalene ring can contribute to its stability and hydrophobic characteristics, influencing its interaction with biological systems. Additionally, the compound may undergo various chemical reactions, including hydrazone formation and oxidation, which can be relevant in synthetic applications. Overall, N-2-Naphthalenylglycine hydrazide represents a versatile structure with potential applications in medicinal chemistry and materials science.
Formula:C12H13N3O
InChI:InChI=1S/C12H13N3O/c13-15-12(16)8-14-11-6-5-9-3-1-2-4-10(9)7-11/h1-7,14H,8,13H2,(H,15,16)
InChI key:InChIKey=IFOZONXHXWJEQA-UHFFFAOYSA-N
SMILES:N(CC(NN)=O)C1=CC2=C(C=C1)C=CC=C2
Synonyms:- N-2-Naphthalenylglycine hydrazide
- MC 1415
- (Naphthalen-2-ylamino)-acetic acid hydrazide
- Glycine, N-2-naphthalenyl-, hydrazide
- Glycine, N-2-naphthyl-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.