CAS 70960-97-3
:4-amino-5-fluoropentanoic acid
Description:
4-Amino-5-fluoropentanoic acid, with the CAS number 70960-97-3, is an amino acid derivative characterized by the presence of an amino group (-NH2) and a fluorine atom attached to a pentanoic acid backbone. This compound features a five-carbon chain, making it a medium-chain amino acid, and the fluorine substitution typically influences its biochemical properties, potentially enhancing its stability and reactivity. The amino group contributes to its classification as an amino acid, allowing it to participate in various biochemical processes, including protein synthesis and metabolic pathways. The presence of fluorine may also impart unique characteristics, such as altered solubility and interaction with biological systems. 4-Amino-5-fluoropentanoic acid can be utilized in research and pharmaceutical applications, particularly in the development of novel compounds or as a building block in peptide synthesis. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular structure and the surrounding environment, making it a subject of interest in both organic chemistry and medicinal chemistry.
Formula:C5H10FNO2
InChI:InChI=1/C5H10FNO2/c6-3-4(7)1-2-5(8)9/h4H,1-3,7H2,(H,8,9)
SMILES:C(CC(=O)O)C(CF)N
Synonyms:- Pentanoic Acid, 4-Amino-5-Fluoro-
- 4-Amino-5-fluoropentanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.