CymitQuimica logo

CAS 70961-06-7

:

Ethyl 5,5,5-trifluoro-4-hydroxypentanoate

Description:
Ethyl 5,5,5-trifluoro-4-hydroxypentanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. This compound features a pentanoate backbone with a hydroxyl group and three fluorine atoms attached to the fifth carbon, contributing to its unique properties. The presence of trifluoromethyl groups typically enhances the lipophilicity and stability of the molecule, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The hydroxyl group introduces polarity, which can influence solubility and reactivity. Ethyl 5,5,5-trifluoro-4-hydroxypentanoate may exhibit interesting biological activities due to its structural features, and its synthesis often involves multi-step organic reactions. As with many fluorinated compounds, it may also possess distinct physical properties, such as altered boiling and melting points compared to non-fluorinated analogs. Safety and handling precautions are essential due to potential toxicity and environmental impact associated with fluorinated compounds.
Formula:C7H11F3O3
InChI:InChI=1S/C7H11F3O3/c1-2-13-6(12)4-3-5(11)7(8,9)10/h5,11H,2-4H2,1H3
InChI key:InChIKey=MLFNYSMWFXWELZ-UHFFFAOYSA-N
SMILES:C(CCC(OCC)=O)(C(F)(F)F)O
Synonyms:
  • Ethyl 5,5,5-trifluoro-4-hydroxypentanoate
  • Pentanoic acid, 5,5,5-trifluoro-4-hydroxy-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.