CAS 70961-08-9
:4-amino-5,5,5-trifluoropentanoic acid
Description:
4-Amino-5,5,5-trifluoropentanoic acid is an organic compound characterized by the presence of an amino group and a trifluoromethyl group attached to a pentanoic acid backbone. This compound features a five-carbon chain with a carboxylic acid functional group at one end and an amino group at the fourth carbon, along with three fluorine atoms substituting the hydrogen atoms on the fifth carbon. The trifluoromethyl group significantly influences the compound's chemical properties, including its polarity and reactivity. As a result, 4-amino-5,5,5-trifluoropentanoic acid may exhibit unique biological activities and potential applications in pharmaceuticals or agrochemicals. Its structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and acid-base reactions. Additionally, the presence of fluorine atoms often enhances the stability and lipophilicity of the compound, which can affect its bioavailability and interaction with biological systems. Overall, this compound represents a fascinating example of fluorinated amino acids with potential utility in various fields of chemistry and biochemistry.
Formula:C5H8F3NO2
InChI:InChI=1/C5H8F3NO2/c6-5(7,8)3(9)1-2-4(10)11/h3H,1-2,9H2,(H,10,11)
SMILES:C(CC(=O)O)C(C(F)(F)F)N
Synonyms:- Pentanoic Acid, 4-Amino-5,5,5-Trifluoro-
- 4-Amino-5,5,5-trifluoropentanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.