CAS 70961-46-5
:[(2R)-2-amino-4-methylsulfanyl-butanoyl]oxysodium
Description:
The chemical substance known as [(2R)-2-amino-4-methylsulfanyl-butanoyl]oxysodium, with the CAS number 70961-46-5, is an amino acid derivative that features a sulfur-containing side chain. This compound is characterized by its chiral center, which contributes to its specific stereochemistry, denoted by the (2R) configuration. The presence of the amino group (-NH2) indicates its classification as an amino acid, while the butanoyl moiety suggests it has a carboxylic acid functional group, albeit in an esterified form due to the sodium salt component. The methylsulfanyl group introduces unique reactivity and properties, potentially influencing its biological activity and solubility. As a sodium salt, it is likely to exhibit enhanced solubility in aqueous environments, making it suitable for various applications in biochemistry and pharmaceuticals. Overall, this compound's structural features suggest potential roles in metabolic pathways or as a building block in peptide synthesis.
Formula:C5H10NNaO2S
InChI:InChI=1/C5H11NO2S.Na/c1-9-3-2-4(6)5(7)8;/h4H,2-3,6H2,1H3,(H,7,8);/q;+1/p-1/t4-;/m1./s1
SMILES:CSCCC(C(=O)O)N.[Na]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
