CAS 709649-59-2
:(2-Ethoxy-3-methoxybenzyl)methylamine
Description:
(2-Ethoxy-3-methoxybenzyl)methylamine is an organic compound characterized by its complex structure, which includes an aromatic ring substituted with ethoxy and methoxy groups, along with a methylamine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the ethoxy and methoxy substituents can enhance its lipophilicity, potentially affecting its biological activity and interaction with other molecules. Additionally, the compound may exhibit specific reactivity patterns typical of aromatic amines, including electrophilic substitution reactions. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses. As with any chemical substance, proper handling and safety precautions should be observed due to the inherent risks associated with amines.
Formula:C11H17NO2
InChI:InChI=1S/C11H17NO2/c1-4-14-11-9(8-12-2)6-5-7-10(11)13-3/h5-7,12H,4,8H2,1-3H3
InChI key:InChIKey=SXIYABYASXZLFY-UHFFFAOYSA-N
SMILES:O(CC)C1=C(CNC)C=CC=C1OC
Synonyms:- (2-Ethoxy-3-methoxybenzyl)methylamine
- 2-Ethoxy-3-methoxy-N-methylbenzenemethanamine
- [(2-Ethoxy-3-methoxyphenyl)methyl](methyl)amine
- benzenemethanamine, 2-ethoxy-3-methoxy-N-methyl-
- 1-(2-Ethoxy-3-methoxyphenyl)-N-methylmethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.