
CAS 709649-60-5
:N,2,4,5-Tetramethylbenzenemethanamine
Description:
N,2,4,5-Tetramethylbenzenemethanamine, with the CAS number 709649-60-5, is an organic compound characterized by its amine functional group and a complex aromatic structure. This compound features a benzene ring substituted with four methyl groups at the 2, 4, and 5 positions, which contributes to its steric hindrance and potentially affects its reactivity and solubility. The presence of the amine group indicates that it can participate in hydrogen bonding, making it soluble in polar solvents to some extent. The compound is likely to exhibit basic properties due to the amine functionality, which can accept protons. Its unique structure may also influence its physical properties, such as boiling and melting points, as well as its behavior in chemical reactions, including nucleophilic substitutions or electrophilic aromatic substitutions. Due to its specific structure, it may find applications in various fields, including pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, detailed safety and handling information should be consulted, as with any chemical substance.
Formula:C11H17N
InChI:InChI=1S/C11H17N/c1-8-5-10(3)11(7-12-4)6-9(8)2/h5-6,12H,7H2,1-4H3
InChI key:InChIKey=VVXIJEQUGIMYQW-UHFFFAOYSA-N
SMILES:C(NC)C1=C(C)C=C(C)C(C)=C1
Synonyms:- (2,4,5-Trimethylbenzyl)methylamine
- N,2,4,5-Tetramethylbenzenemethanamine
- Benzenemethanamine, N,2,4,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.