CAS 709649-61-6

N-Methyl[1,1′-biphenyl]-3-methanamine

Description:

N-Methyl[1,1′-biphenyl]-3-methanamine, identified by its CAS number 709649-61-6, is an organic compound characterized by its biphenyl structure with a methyl group and an amine functional group. This compound features a central biphenyl moiety, which consists of two phenyl rings connected by a single bond, enhancing its stability and hydrophobic properties. The presence of the N-methyl group indicates that one of the hydrogen atoms on the amine nitrogen is replaced by a methyl group, which can influence its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The amine functional group can participate in hydrogen bonding, affecting its interactions with other molecules. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would depend on its molecular structure and the presence of functional groups. Overall, N-Methyl[1,1′-biphenyl]-3-methanamine represents a class of compounds that may have diverse applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₄H₁₅N

InChI: InChI=1S/C14H15N/c1-15-11-12-6-5-9-14(10-12)13-7-3-2-4-8-13/h2-10,15H,11H2,1H3

InChI key: InChIKey=XUQBOMSXNIPDLM-UHFFFAOYSA-N

SMILES: C(NC)C=1C=C(C=CC1)C2=CC=CC=C2

Synonyms:

• N-Methyl[1,1′-biphenyl]-3-methanamine
• (Biphenyl-3-ylmethyl)methylamine
• [1,1′-Biphenyl]-3-methanamine, N-methyl-
• 3-((Methylamino)methyl)biphenyl