CymitQuimica logo

CAS 709649-71-8

:

N-Methylthieno[3,2-c]pyridine-2-methanamine

Description:
N-Methylthieno[3,2-c]pyridine-2-methanamine is a chemical compound characterized by its unique bicyclic structure, which incorporates both a thieno and a pyridine ring. This compound features a methyl group attached to the nitrogen atom of the pyridine ring and a methanamine functional group, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. The compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and pharmacology. Its CAS number, 709649-71-8, allows for precise identification in chemical databases. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including alkylation and acylation, and could serve as a precursor for the synthesis of more complex molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H10N2S
InChI:InChI=1S/C9H10N2S/c1-10-6-8-4-7-5-11-3-2-9(7)12-8/h2-5,10H,6H2,1H3
InChI key:InChIKey=NRLQDHIBSGMYGV-UHFFFAOYSA-N
SMILES:C(NC)C1=CC=2C(S1)=CC=NC2
Synonyms:
  • Methyl[(thieno[3,2-c]pyridin-2-yl)methyl]amine
  • N-Methylthieno[3,2-c]pyridine-2-methanamine
  • Thieno[3,2-c]pyridine-2-methanamine, N-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.