CAS 709649-75-2

N-methyl-1-(1-methylindol-7-yl)methanamine

Description:

N-methyl-1-(1-methylindol-7-yl)methanamine, identified by its CAS number 709649-75-2, is a chemical compound that features a structure comprising an indole moiety substituted with a methyl group and an amine functional group. This compound is characterized by its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. The presence of the indole ring suggests that it may interact with various biological targets, potentially influencing neurotransmitter systems. Its methylation at the nitrogen atom enhances lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the compound's amine group may participate in hydrogen bonding, influencing its solubility and reactivity. Overall, N-methyl-1-(1-methylindol-7-yl)methanamine is of interest for its structural features that may confer specific pharmacological properties, making it a subject of research in drug development and related fields.

Formula: C₁₁H₁₄N₂

InChI: InChI=1/C11H14N2/c1-12-8-10-5-3-4-9-6-7-13(2)11(9)10/h3-7,12H,8H2,1-2H3

SMILES: CNCc1cccc2ccn(C)c12

1-Methyl-7-[(methylamino)methyl]-1H-indole

CAS: 709649-75-2

1-Methyl-7-[(methylamino)methyl]-1H-indole

Purity: 90%

Color and Shape: Solid

Molecular weight: 174.24g/mol

Ref: 54-OR30803