CymitQuimica logo

CAS 709651-39-8

:

1-(2-ethoxyphenyl)-N-methylmethanamine

Description:
1-(2-Ethoxyphenyl)-N-methylmethanamine, identified by its CAS number 709651-39-8, is an organic compound characterized by its amine functional group and an ethoxy-substituted phenyl ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the ethoxy group enhances its lipophilicity, potentially affecting its biological activity and interaction with cellular membranes. The molecular structure suggests that it may participate in various chemical reactions, including alkylation and acylation, and could serve as a precursor or intermediate in the synthesis of more complex molecules. Additionally, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or literature review. Overall, this compound represents a class of substances that may have applications in pharmaceuticals or agrochemicals.
Formula:C10H15NO
InChI:InChI=1/C10H15NO/c1-3-12-10-7-5-4-6-9(10)8-11-2/h4-7,11H,3,8H2,1-2H3
SMILES:CCOc1ccccc1CNC
Synonyms:
  • benzenemethanamine, 2-ethoxy-N-methyl-
  • N-(2-ethoxybenzyl)-N-methylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.