CAS 709652-82-4

2-amino-5-bromonicotinonitrile

Description:

2-Amino-5-bromonicotinonitrile is a chemical compound characterized by its pyridine ring structure, which includes an amino group and a bromine atom as substituents. The presence of the nitrile group (-C≡N) contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the amino group. The bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may possess biological activity, making it of interest in pharmaceutical research. Its CAS number, 709652-82-4, allows for precise identification in chemical databases and literature. Overall, 2-amino-5-bromonicotinonitrile is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₆H₄BrN₃

InChI: InChI=1/C6H4BrN3/c7-5-1-4(2-8)6(9)10-3-5/h1,3H,(H2,9,10)

SMILES: c1c(C#N)c(=N)[nH]cc1Br

Synonyms:

• 3-Pyridinecarbonitrile, 2-amino-5-bromo-
• 5-Bromo-3-cyanopyridin-2-amine
• 2-Amino-5-Bromo-Pyridine-3-Carbonitrile
• 2-Amino-5-Bromo-Nicotinonitrile
• 2-Amino-5-bromo-3-pyridinecarbonitrile

2-Amino-5-bromonicotinonitrile

CAS: 709652-82-4

Formula: C₆H₄BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.0201

Ref: IN-DA003GGO

2-Amino-5-bromo-3-cyanopyridine

CAS: 709652-82-4

2-Amino-5-bromo-3-cyanopyridine

Formula: C₆H₄BrN₃

Purity: 97%

Color and Shape: faint beige solid

Molecular weight: 198.02g/mol

Ref: 54-OR345399

2-Amino-5-bromonicotinonitrile

CAS: 709652-82-4

Formula: C₆H₄BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.023

Ref: 10-F076438