CAS 70967-97-4
:N-(3-carboxypropanoyl)-L-alanyl-L-alanyl-N-{(2S)-2-[(4-nitrophenyl)amino]-3-phenylpropanoyl}-L-prolinamide
Description:
N-(3-carboxypropanoyl)-L-alanyl-L-alanyl-N-{(2S)-2-[(4-nitrophenyl)amino]-3-phenylpropanoyl}-L-prolinamide, with CAS number 70967-97-4, is a complex organic compound characterized by its peptide-like structure, which includes multiple amino acid residues and functional groups. This substance features a carboxylic acid group, which contributes to its solubility in polar solvents, and an amide bond, indicative of its peptide nature. The presence of a nitrophenyl group suggests potential applications in biochemical assays or as a chromophore in spectroscopic studies. Its stereochemistry, denoted by the L- and S- configurations, implies specific spatial arrangements that can influence its biological activity and interactions with enzymes or receptors. The compound's molecular weight and specific reactivity can be influenced by the arrangement of its functional groups, making it of interest in medicinal chemistry and peptide synthesis. Overall, this compound exemplifies the complexity and diversity of peptide derivatives in chemical research and potential therapeutic applications.
Formula:C30H36N6O9
InChI:InChI=1/C30H36N6O9/c1-18(31-25(37)14-15-26(38)39)27(40)32-19(2)30(43)35-16-6-9-24(35)29(42)34-28(41)23(17-20-7-4-3-5-8-20)33-21-10-12-22(13-11-21)36(44)45/h3-5,7-8,10-13,18-19,23-24,33H,6,9,14-17H2,1-2H3,(H,31,37)(H,32,40)(H,38,39)(H,34,41,42)/t18-,19-,23-,24-/m0/s1
Synonyms:- Suc-Ala-Ala-Pro-Phe-Pna
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Suc-Ala-Ala-Pro-Phe-pNA
CAS:A readily soluble, specific and sensitive substrate for chymotrypsin and human pancreatic elastase. It is also hydrolyzed by cathepsin G and chymase. Furthermore it is the standard substrate for FK-506 binding proteins (FKBPs, also called macrophilins) and cyclophilins, which belong to the group of peptidyl prolyl cis-trans isomerases (PPIases). Thus, Suc-AAPF-pNA has been used for an uncoupled protease-free assay of PPIase activity.Formula:C30H36N6O9Purity:> 99%Color and Shape:WhitishMolecular weight:624.65Suc-Ala-Ala-Pro-Phe-pNA
CAS:Formula:C30H36N6O9Purity:95%Color and Shape:SolidMolecular weight:624.6416Suc-AAPF-pNA
CAS:Suc-AAPF-pNA (Suc-Ala-Ala-Pro-Phe-pNA) is a chromogen,a substrate proteases and prostate-specific antigens (PAs), to identify protein hydrolytic activities.Formula:C30H36N6O9Purity:99.48%Color and Shape:SolidMolecular weight:624.64N-Succinyl-Ala-Ala-Pro-Phe p-nitroanilide
CAS:Formula:C30H36N6O9Purity:≥ 97.0%Color and Shape:White to light yellow powderMolecular weight:624.64Suc-Ala-Ala-Pro-Phe-pNA
CAS:Suc-Ala-Ala-Pro-Phe-pNAColor and Shape:Whitish PowderMolecular weight:624.64g/molSuc-Ala-Ala-Pro-Phe-pNA
CAS:<p>N-Succinyl-L-alanyl-L-alanyl-L-prolyl-L-phenylalanine 4-nitroanilide is a colorimetric substrate for peptidyl-prolyl isomerase, chymotrypsin and human leukocyte cathepsin G but not reactive with elastase.</p>Formula:C30H36N6O9Purity:Min. 95%Color and Shape:PowderMolecular weight:624.64 g/molN-Succinyl-L-alanyl-L-alanyl-L-prolyl-L-phenylalanine p-nitroanilide
CAS:Controlled ProductFormula:C30H36N6O9Color and Shape:NeatMolecular weight:624.642N-Succinyl-L-alanyl-L-alanyl-L-prolyl-L-phenylalanine 4-nitroanilide
CAS:<p>N-Succinyl-L-alanyl-L-alanyl-L-prolyl-L-phenylalanine 4-nitroanilide is a colorimetric substrate for peptidyl-prolyl isomerase, chymotrypsin and human leukocyte cathepsin G but not reactive with elastase.</p>Formula:C30H36N6O9Purity:Min. 98.0 Area-%Molecular weight:624.66 g/mol






