CymitQuimica logo

CAS 7097-89-4

:

2-isothiocyanato-N,N-dimethylethanaminium

Description:
2-Isothiocyanato-N,N-dimethylethanaminium, with the CAS number 7097-89-4, is a chemical compound characterized by the presence of an isothiocyanate functional group attached to a dimethylaminoethyl moiety. This compound typically exhibits a polar nature due to the presence of the quaternary ammonium group, which enhances its solubility in polar solvents. It is often used in organic synthesis and may serve as a reagent in various chemical reactions, particularly in the formation of thioureas and other nitrogen-containing compounds. The isothiocyanate group is known for its reactivity, particularly in nucleophilic substitution reactions, making this compound valuable in medicinal chemistry and agrochemical applications. Additionally, the presence of the dimethylamino group can influence the compound's biological activity, potentially affecting its interaction with biological systems. Safety data should be consulted, as isothiocyanates can be irritants and may pose health risks upon exposure. Overall, 2-isothiocyanato-N,N-dimethylethanaminium is a versatile compound with significant utility in various chemical contexts.
Formula:C5H11N2S
InChI:InChI=1/C5H10N2S/c1-7(2)4-3-6-5-8/h3-4H2,1-2H3/p+1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.