
CAS 7097-93-0
:Butanoic acid, 3-oxo-, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester
Description:
Butanoic acid, 3-oxo-, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester, also known by its CAS number 7097-93-0, is an organic compound characterized by its ester functional group and a butanoic acid moiety. This compound features a butanoic acid backbone with a keto group at the third carbon, indicating the presence of a carbonyl group (C=O) adjacent to the carboxylic acid. The "oxybis(2,1-ethanediyloxy-2,1-ethanediyl)" part of the name suggests that it contains two ether linkages derived from ethylene glycol units, which contribute to its solubility and reactivity. Generally, esters like this compound are known for their pleasant odors and are often used in flavoring and fragrance applications. Additionally, the presence of multiple functional groups may impart unique properties such as increased reactivity or specific interactions in biological systems. Overall, this compound's structure suggests potential applications in various fields, including pharmaceuticals, materials science, and chemical synthesis.
Formula:C16H26O9
InChI:InChI=1S/C16H26O9/c1-13(17)11-15(19)24-9-7-22-5-3-21-4-6-23-8-10-25-16(20)12-14(2)18/h3-12H2,1-2H3
InChI key:InChIKey=GLZCRVUEFBMCJQ-UHFFFAOYSA-N
SMILES:C(C(OCCOCCOCCOCCOC(CC(C)=O)=O)=O)C(C)=O
Synonyms:- Acetoacetic acid, diester with tetraethylene glycol
- Butanoic acid, 3-oxo-, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Butanoic acid, 3-oxo-, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester
CAS:Formula:C16H26O9Molecular weight:362.3722
