CAS 70976-76-0

N-[2-(Diethylamino)ethyl]-α-methyl[1,1′-biphenyl]-4-acetamide

Description:

N-[2-(Diethylamino)ethyl]-α-methyl[1,1′-biphenyl]-4-acetamide, with the CAS number 70976-76-0, is a chemical compound that belongs to the class of amides. It features a biphenyl structure, which contributes to its unique properties, and contains a diethylamino group that enhances its solubility and potential biological activity. This compound is characterized by its relatively high molecular weight and specific functional groups that may influence its reactivity and interaction with biological systems. It is often studied for its pharmacological properties, particularly in relation to its potential use as a therapeutic agent. The presence of the acetamide group suggests that it may exhibit characteristics typical of amide compounds, such as hydrogen bonding capabilities. Additionally, the diethylamino moiety can impart basicity, affecting its behavior in various chemical environments. Overall, this compound's structure suggests a complex interplay of physical and chemical properties that can be explored for various applications in medicinal chemistry and drug development.

Formula: C₂₁H₂₈N₂O

InChI: InChI=1S/C21H28N2O/c1-4-23(5-2)16-15-22-21(24)17(3)18-11-13-20(14-12-18)19-9-7-6-8-10-19/h6-14,17H,4-5,15-16H2,1-3H3,(H,22,24)

InChI key: InChIKey=GXLWOFJVIBEMCS-UHFFFAOYSA-N

SMILES: C(C(NCCN(CC)CC)=O)(C)C1=CC=C(C=C1)C2=CC=CC=C2

Synonyms:

• [1,1′-Biphenyl]-4-acetamide, N-[2-(diethylamino)ethyl]-α-methyl-
• Bifepramide
• [1,1′-Biphenyl]-4-acetamide, N-[2-(diethylamino)ethyl]-α-methyl-, (±)-
• N-[2-(Diethylamino)ethyl]-α-methyl[1,1′-biphenyl]-4-acetamide

Bifepramide Hydrochloride

Controlled Product

CAS: 70976-76-0

Formula: C₂₁H₂₈N₂O·HCl

Color and Shape: Neat

Molecular weight: 360.93

Ref: TR-B383030