CAS 70977-71-8
:1-(3-amino-2-hydroxy-5-methylphenyl)ethanone
Description:
1-(3-amino-2-hydroxy-5-methylphenyl)ethanone, also known by its CAS number 70977-71-8, is an organic compound characterized by its functional groups and structural features. It contains an ethanone moiety, indicating the presence of a ketone group, along with an amino group and a hydroxyl group attached to a phenyl ring. The presence of the amino group suggests potential basicity and reactivity in various chemical reactions, while the hydroxyl group contributes to its polarity and solubility in polar solvents. The methyl group on the phenyl ring can influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical and medicinal chemistry. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 1-(3-amino-2-hydroxy-5-methylphenyl)ethanone is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C9H11NO2
InChI:InChI=1/C9H11NO2/c1-5-3-7(6(2)11)9(12)8(10)4-5/h3-4,12H,10H2,1-2H3
SMILES:Cc1cc(C(=O)C)c(c(c1)N)O
Synonyms:- Ethanone, 1-(3-Amino-2-Hydroxy-5-Methylphenyl)-
- 1-(3-Amino-2-hydroxy-5-methylphenyl)ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Amino-2-hydroxy-5-methylacetophenone
CAS:3-Amino-2-hydroxy-5-methylacetophenone is a reagent for organic synthesis, which is used as a building block for the preparation of various chemical compounds. 3-Amino-2-hydroxy-5-methylacetophenone has been shown to be an intermediate in the synthesis of pharmaceuticals. Due to its versatility, this compound can be used as a reaction component, and is also used as a building block in the preparation of speciality chemicals. This product has high quality, and can be used as a useful scaffold or building block in research chemicals. The CAS number for 3-amino-2 hydroxy 5 methyl acetophenone is 70977 71 8.Formula:C9H11NO2Purity:Min. 95%Molecular weight:165.19 g/mol

