CAS 70977-72-9
:3-Amino-2-hydroxyacetophenone
Description:
3-Amino-2-hydroxyacetophenone, with the CAS number 70977-72-9, is an organic compound characterized by the presence of both an amino group and a hydroxyl group attached to an acetophenone structure. This compound typically appears as a solid and is soluble in polar solvents due to its functional groups. The amino group (-NH2) contributes to its basicity, while the hydroxyl group (-OH) can participate in hydrogen bonding, enhancing its solubility in water. The presence of these functional groups also suggests potential reactivity, making it useful in various chemical syntheses, including the production of dyes, pharmaceuticals, and other organic compounds. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Its melting point, boiling point, and specific reactivity would depend on the conditions and purity of the sample. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-5(10)6-3-2-4-7(9)8(6)11/h2-4,11H,9H2,1H3
InChI key:InChIKey=NLLYXOVHEQVWJF-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(O)C(N)=CC=C1
Synonyms:- 1-(3-Amino-2-Hydroxyphenyl)Ethanone
- 2-Acetyl-6-aminophenol
- 3-Amino-2-Hydroxy Acephone
- 3-Amino-2-hydroxyacetophenone
- Acetophenone, 3′-amino-2′-hydroxy-
- Ethanone, 1-(3-amino-2-hydroxyphenyl)-
- Ethanone,1-(3-amino-2-hydroxyphenyl)-(9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethanone, 1-(3-amino-2-hydroxyphenyl)-
CAS:Formula:C8H9NO2Purity:98%Color and Shape:SolidMolecular weight:151.16261-(3-Amino-2-hydroxyphenyl)ethanone
CAS:1-(3-Amino-2-hydroxyphenyl)ethanonePurity:99%Molecular weight:151.16g/mol3'-Amino-2'-hydroxyacetophenone
CAS:3'-Amino-2'-hydroxyacetophenone is a synthetic compound that reacts with salicylaldehyde and hydrochloric acid to form an aromatic hydrocarbon. The reaction vessel used is made of glass and contains potassium dichromate, copper complex, and nitro. This product can be produced in acidic conditions with the addition of phosphotungstic acid and chloride. 3'-Amino-2'-hydroxyacetophenone can also be produced by reacting mercuric chloride, which is an oxidizing agent, with an aromatic hydrocarbon. This product has a rotator.
Formula:C8H9NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:151.16 g/mol3′-Amino-2′-hydroxyacetophenone
CAS:Formula:C8H9NO2Purity:97%Color and Shape:SolidMolecular weight:151.165



