CymitQuimica logo

CAS 70978-57-3

:

2,2,2-Trifluoro-1-(2-hydroxy-5-methylphenyl)ethanone

Description:
2,2,2-Trifluoro-1-(2-hydroxy-5-methylphenyl)ethanone, with CAS number 70978-57-3, is an organic compound characterized by its unique trifluoromethyl group and a phenolic hydroxyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits a relatively high boiling point due to the presence of the trifluoromethyl group, which enhances its polarity and affects its solubility in various solvents. The hydroxyl group contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Its trifluoromethyl group is known to influence the electronic properties of the molecule, potentially enhancing its lipophilicity and stability. Overall, 2,2,2-Trifluoro-1-(2-hydroxy-5-methylphenyl)ethanone is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its distinctive structural features.
Formula:C9H7F3O2
InChI:InChI=1S/C9H7F3O2/c1-5-2-3-7(13)6(4-5)8(14)9(10,11)12/h2-4,13H,1H3
InChI key:InChIKey=BQXJLIFASBKZNO-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=C(O)C=CC(C)=C1
Synonyms:
  • 2,2,2-Trifluoro-1-(2-Hydroxy-5-Methylphenyl)Ethanone
  • Ethanone, 2,2,2-trifluoro-1-(2-hydroxy-5-methylphenyl)-
Sort by
Found 1 products.