
CAS 70978-89-1
:4-(2-Phenoxyethoxy)piperidine
Description:
4-(2-Phenoxyethoxy)piperidine, with the CAS number 70978-89-1, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a phenoxyethoxy substituent, indicating the presence of a phenyl group connected through an ether linkage to an ethoxy group. The structure suggests that it may exhibit properties typical of both piperidine derivatives and ether compounds, potentially influencing its solubility, reactivity, and biological activity. It is likely to be a polar compound due to the presence of the ether functional group, which can enhance its interaction with polar solvents. The presence of the piperidine ring may also impart basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. However, specific details regarding its toxicity, stability, and reactivity would require further investigation and analysis.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c1-2-4-12(5-3-1)15-10-11-16-13-6-8-14-9-7-13/h1-5,13-14H,6-11H2
InChI key:InChIKey=XSADPCARLFCVPX-UHFFFAOYSA-N
SMILES:O(CCOC1CCNCC1)C2=CC=CC=C2
Synonyms:- 4-(2-Phenoxyethoxy)piperidine
- Piperidine, 4-(2-phenoxyethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.