CymitQuimica logo

CAS 70979-02-1

:

4-(2-Methoxypropoxy)piperidine

Description:
4-(2-Methoxypropoxy)piperidine, with the CAS number 70979-02-1, is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a methoxypropoxy group attached to the fourth position of the piperidine ring, contributing to its unique chemical properties. The presence of the ether functional group (methoxy) enhances its solubility in organic solvents and may influence its biological activity. Typically, compounds like this can exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, reactivity, and potential for forming hydrogen bonds are influenced by the functional groups present. As with many piperidine derivatives, it may also exhibit basic properties due to the nitrogen atom in the ring, allowing it to participate in protonation reactions. Overall, 4-(2-Methoxypropoxy)piperidine is a compound of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C9H19NO2
InChI:InChI=1S/C9H19NO2/c1-8(11-2)7-12-9-3-5-10-6-4-9/h8-10H,3-7H2,1-2H3
InChI key:InChIKey=MNRJBWWZVOCYSN-UHFFFAOYSA-N
SMILES:O(CC(OC)C)C1CCNCC1
Synonyms:
  • 4-(2-Methoxypropoxy)piperidine
  • Piperidine, 4-(2-methoxypropoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.