CAS 70982-53-5
:(2S)-2-Amino-3-butenoic acid
Description:
(2S)-2-Amino-3-butenoic acid, also known as L-2-amino-3-butenoic acid, is an amino acid characterized by its unique structure, which includes a double bond in the side chain. This compound features an amino group (-NH2), a carboxylic acid group (-COOH), and a butenoic acid moiety, making it a member of the α-amino acid family. It is a chiral molecule, with the "S" configuration indicating the specific spatial arrangement of its atoms. This amino acid is involved in various biochemical processes and can serve as a precursor for other important compounds. Its solubility in water is typical for amino acids, and it exhibits both acidic and basic properties due to the presence of the carboxylic acid and amino groups. The compound's reactivity can be influenced by the presence of the double bond, which may participate in various chemical reactions. Overall, (2S)-2-amino-3-butenoic acid is significant in both biological systems and synthetic chemistry applications.
Formula:C4H7NO2
InChI:InChI=1S/C4H7NO2/c1-2-3(5)4(6)7/h2-3H,1,5H2,(H,6,7)/t3-/m0/s1
InChI key:InChIKey=RQVLGLPAZTUBKX-VKHMYHEASA-N
SMILES:[C@@H](C(O)=O)(C=C)N
Synonyms:- (2S)-2-Amino-3-butenoic acid
- (S)-2-Amino-3-butenoic acid
- (S)-Vinylglycine
- 3-Butenoic acid, 2-amino-, (2S)-
- 3-Butenoic acid, 2-amino-, (S)-
- <span class="text-smallcaps">L</span>-2-Vinylglycine
- <span class="text-smallcaps">L</span>-Vinylglycine
- L-2-Vinylglycine
- L-Vinylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
