
CAS 70987-79-0
:Benzonitrile, 4-[(2R)-oxiranylmethoxy]-
Description:
Benzonitrile, 4-[(2R)-oxiranylmethoxy]- is an organic compound characterized by the presence of a benzonitrile group, which consists of a benzene ring attached to a nitrile (-C≡N) functional group, along with an epoxide (oxirane) moiety. The compound features a methoxy group linked to the epoxide, indicating that it has both ether and nitrile functionalities. This structure suggests that it may exhibit polar characteristics due to the presence of the nitrile and ether groups, which can influence its solubility in various solvents. The epoxide ring introduces reactivity, making it a potential candidate for further chemical transformations. Benzonitrile derivatives are often utilized in organic synthesis and can serve as intermediates in the production of pharmaceuticals, agrochemicals, and other fine chemicals. The specific stereochemistry indicated by the (2R) designation suggests that the compound has a defined spatial arrangement, which can affect its reactivity and interactions with biological systems. Overall, this compound's unique structure may confer specific properties that are valuable in various chemical applications.
Formula:C10H9NO2
InChI:InChI=1S/C10H9NO2/c11-5-8-1-3-9(4-2-8)12-6-10-7-13-10/h1-4,10H,6-7H2/t10-/m0/s1
InChI key:InChIKey=WREXVDPOLDOXJL-JTQLQIEISA-N
SMILES:C(OC1=CC=C(C#N)C=C1)[C@H]2CO2
Synonyms:- (r)-4-(Oxiran-2-ylmethoxy)benzonitrile
- Benzonitrile, 4-[(2R)-oxiranylmethoxy]-
- Benzonitrile, 4-(oxiranylmethoxy)-, (R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.