CAS 71-50-1
:Acetate ion
Description:
The acetate ion, commonly represented as CH3COO⁻, is a negatively charged ion derived from acetic acid. It consists of a methyl group (CH3) attached to a carboxylate group (COO⁻). Acetate is a key intermediate in various biochemical processes, including cellular respiration and metabolism. It plays a crucial role in the synthesis of fatty acids and serves as a building block for numerous organic compounds. Acetate ions are highly soluble in water, making them readily available in biological systems and industrial applications. They are often used in buffer solutions due to their ability to maintain pH levels. The acetate ion is also involved in the formation of esters, which are important in the production of fragrances, flavors, and polymers. In terms of safety, acetate salts are generally considered non-toxic, but handling should still follow standard laboratory safety protocols. The CAS number 71-50-1 specifically refers to ethyl acetate, a common ester derived from acetic acid, which is widely used as a solvent in various applications.
Formula:C2H3O2
InChI:InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1
InChI key:InChIKey=QTBSBXVTEAMEQO-UHFFFAOYSA-M
SMILES:C(C)([O-])=O
Synonyms:- Acetic acid, ion(1-)
- Acetate ion
- Acetic acid anion
- Acetate
- Acetoxy ion
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery