CAS 710-31-6
:2-[(4-fluorophenyl)amino]acetohydrazide (non-preferred name)
Description:
2-[(4-Fluorophenyl)amino]acetohydrazide, also known by its CAS number 710-31-6, is an organic compound characterized by the presence of a hydrazide functional group attached to an acetyl moiety and a para-fluorophenyl group. This compound typically appears as a solid and is soluble in polar solvents due to its hydrophilic nature. The presence of the fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties and reactivity, potentially enhancing its biological activity. The amino and hydrazide functionalities suggest that it may participate in various chemical reactions, including condensation and substitution reactions. This compound may be of interest in medicinal chemistry for its potential pharmacological properties, as derivatives of hydrazides are often explored for their antibacterial, antifungal, and anticancer activities. However, specific applications and biological activities would require further investigation through empirical studies. Safety data should also be consulted, as with any chemical substance, to ensure proper handling and usage.
Formula:C8H10FN3O
InChI:InChI=1/C8H10FN3O/c9-6-1-3-7(4-2-6)11-5-8(13)12-10/h1-4,11H,5,10H2,(H,12,13)
SMILES:c1cc(ccc1F)NCC(=NN)O
Synonyms:- 2-(4-Fluoroanilino)Ethanohydrazide
- 2-[(4-Fluorophenyl)amino]acetohydrazide (non-preferred name)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
