CAS 710-37-2

(2E)-3-[(4-methylphenyl)sulfanyl]prop-2-enoic acid

Description:

(2E)-3-[(4-methylphenyl)sulfanyl]prop-2-enoic acid, also known as 4-methylphenyl thioacrylic acid, is an organic compound characterized by its unique structure, which includes a prop-2-enoic acid backbone with a thioether functional group. This compound features a double bond between the second and third carbon atoms, contributing to its reactivity and potential for polymerization. The presence of the 4-methylphenyl group enhances its hydrophobic characteristics, while the carboxylic acid group provides acidic properties, allowing for potential interactions in various chemical environments. The thioether linkage introduces sulfur into the molecule, which can influence its reactivity and stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its solubility in organic solvents and limited solubility in water are typical for similar organic compounds, and it may participate in various chemical reactions, including nucleophilic substitutions and addition reactions, due to the presence of both the double bond and the functional groups.

Formula: C₁₀H₁₀O₂S

InChI: InChI=1/C10H10O2S/c1-8-2-4-9(5-3-8)13-7-6-10(11)12/h2-7H,1H3,(H,11,12)/b7-6+

(2Z)-3-[(4-Methylphenyl)sulfanyl]prop-2-enoic acid

CAS: 710-37-2

Versatile small molecule scaffold

Formula: C₁₀H₁₀O₂S

Purity: Min. 95%

Molecular weight: 194.25 g/mol

Ref: 3D-AAA71037