CAS 710-65-6
:2,2,3,3,5,5,6,6-octafluoro-1,4-dithiane
Description:
2,2,3,3,5,5,6,6-octafluoro-1,4-dithiane, with the CAS number 710-65-6, is a fluorinated organic compound characterized by its unique structure, which includes a dithiane ring with eight fluorine atoms substituting hydrogen atoms. This compound is notable for its high thermal and chemical stability, largely due to the presence of fluorine, which enhances its resistance to oxidation and degradation. It is a colorless liquid at room temperature and exhibits low volatility. The presence of fluorine atoms imparts significant hydrophobic properties, making it insoluble in water but soluble in organic solvents. Additionally, 2,2,3,3,5,5,6,6-octafluoro-1,4-dithiane is used in various applications, including as a solvent in chemical reactions and as a reagent in organic synthesis. Its unique properties make it of interest in materials science and fluorine chemistry, although handling requires caution due to potential toxicity and environmental concerns associated with fluorinated compounds.
Formula:C4F8S2
InChI:InChI=1/C4F8S2/c5-1(6)2(7,8)14-4(11,12)3(9,10)13-1
SMILES:C1(C(F)(F)SC(C(F)(F)S1)(F)F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.