
CAS 71004-93-8
:2-Propenoic acid, 2-methyl-, methyl ester, polymer with 3,6,9,12-tetraoxatridec-1-yl 2-methyl-2-propenoate
Description:
The chemical substance known as "2-Propenoic acid, 2-methyl-, methyl ester, polymer with 3,6,9,12-tetraoxatridec-1-yl 2-methyl-2-propenoate," with the CAS number 71004-93-8, is a polymeric compound derived from the polymerization of methacrylic acid esters. This substance typically exhibits characteristics common to poly(methacrylate) polymers, such as good thermal stability, resistance to chemicals, and flexibility. The presence of the tetraoxatridecyl group suggests that the polymer may have enhanced solubility in polar solvents and improved compatibility with other materials. Its structure likely contributes to properties such as adhesion, film-forming ability, and potential applications in coatings, adhesives, and sealants. Additionally, the polymer's molecular weight and degree of polymerization can significantly influence its physical properties, including viscosity and mechanical strength. Overall, this compound is of interest in various industrial applications due to its versatile characteristics and functional properties.
Formula:(C13H24O6·C5H8O2)x
InChI:InChI=1S/C13H24O6.C5H8O2/c1-12(2)13(14)19-11-10-18-9-8-17-7-6-16-5-4-15-3;1-4(2)5(6)7-3/h1,4-11H2,2-3H3;1H2,2-3H3
InChI key:InChIKey=NONFONSQRFFAAI-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCOC)OC(C(C)=C)=O.C(C(C)=C)(OC)=O
Synonyms:- Methyl methacrylate-tetraethylene glycol methyl ether methacrylate copolymer
- Methoxytetraethylene glycol methacrylate-methyl methacrylate copolymer
- 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 3,6,9,12-tetraoxatridec-1-yl 2-methyl-2-propenoate
- 2-Propenoic acid, 2-methyl-, 3,6,9,12-tetraoxatridec-1-yl ester, polymer with methyl 2-methyl-2-propenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propenoic acid, 2-methyl-, methyl ester, polymer with 3,6,9,12-tetraoxatridec-1-yl 2-methyl-2-propenoate
CAS:Formula:C18H32O8Molecular weight:376.4419
