
CAS 71009-17-1
:α-2-Naphthalenyl-1H-imidazole-1-ethanol
Description:
α-2-Naphthalenyl-1H-imidazole-1-ethanol, with the CAS number 71009-17-1, is a chemical compound characterized by its imidazole ring structure fused with a naphthalene moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the imidazole group, which is known for its role in various biochemical processes. The hydroxyl (-OH) group in the ethanol portion contributes to its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The compound's structure suggests it may participate in hydrogen bonding, which can affect its physical properties such as melting point and boiling point. Additionally, its naphthalene component may impart certain optical properties, making it of interest in studies related to fluorescence or photochemistry. Overall, α-2-Naphthalenyl-1H-imidazole-1-ethanol is a compound of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C15H14N2O
InChI:InChI=1S/C15H14N2O/c18-15(10-17-8-7-16-11-17)14-6-5-12-3-1-2-4-13(12)9-14/h1-9,11,15,18H,10H2
InChI key:InChIKey=LFAPKHXSAABGPQ-UHFFFAOYSA-N
SMILES:C(CN1C=CN=C1)(O)C2=CC3=C(C=C2)C=CC=C3
Synonyms:- 1-[2-Hydroxy-2-(2-naphthyl)ethyl]imidazole
- 1H-Imidazole-1-ethanol, α-2-naphthalenyl-
- RS 81297
- 2-(1H-Imidazol-1-yl)-1-(naphthalen-2-yl)ethan-1-ol
- α-2-Naphthalenyl-1H-imidazole-1-ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Nafimidone alcohol
CAS:Nafimidone alcohol is a Nafimidone metabolite.Formula:C15H14N2OColor and Shape:SolidMolecular weight:238.28
