
CAS 7101-57-7
:N,N-Diethyl-1,2,3,4-tetrahydro-9-acridinecarboxamide
Description:
N,N-Diethyl-1,2,3,4-tetrahydro-9-acridinecarboxamide, with the CAS number 7101-57-7, is a chemical compound that belongs to the class of acridine derivatives. This substance is characterized by its bicyclic structure, which includes an acridine moiety fused with a tetrahydro group, contributing to its unique properties. It typically appears as a solid or crystalline material and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of diethyl groups enhances its lipophilicity, which can influence its bioavailability and interaction with biological systems. Additionally, the amide functional group in its structure may impart specific reactivity and stability characteristics. While specific physical and chemical properties such as melting point, solubility, and spectral data may vary, this compound is generally studied for its pharmacological effects and potential therapeutic uses. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C18H22N2O
InChI:InChI=1S/C18H22N2O/c1-3-20(4-2)18(21)17-13-9-5-7-11-15(13)19-16-12-8-6-10-14(16)17/h5,7,9,11H,3-4,6,8,10,12H2,1-2H3
InChI key:InChIKey=BODGAMBTBSTNOV-UHFFFAOYSA-N
SMILES:C(N(CC)CC)(=O)C1=C2C(=NC=3C1=CC=CC3)CCCC2
Synonyms:- 1,2,3,4-Tetrahydro-acridine-9-carboxylic acid diethylamide
- 9-Acridinecarboxamide, N,N-diethyl-1,2,3,4-tetrahydro-
- N,N-Diethyl-1,2,3,4-tetrahydro-9-acridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acridine-9-carboxamide, 1,2,3,4-tetrahydro-N,N-diethyl-
CAS:Acridine-9-carboxamide, 1,2,3,5-tetrahydro-N,N-diethyl- is a biochemcial.Formula:C18H22N2OColor and Shape:SolidMolecular weight:282.38
