
CAS 7101-63-5
:7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate
Description:
7,8,9,10-tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylate, with the CAS number 7101-63-5, is a bicyclic compound characterized by its unique fused ring structure, which includes a cycloheptane and a quinoline moiety. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylate functional group. The tetrahydro configuration suggests that it is a saturated derivative, which may influence its stability and reactivity compared to unsaturated analogs. It may also display biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the carboxylate group can facilitate interactions with biological targets, potentially leading to various therapeutic applications. Overall, the compound's structural features contribute to its chemical behavior and potential utility in research and development within the fields of organic and medicinal chemistry.
Formula:C15H14NO2
InChI:InChI=1/C15H15NO2/c17-15(18)14-10-6-2-1-3-8-12(10)16-13-9-5-4-7-11(13)14/h4-5,7,9H,1-3,6,8H2,(H,17,18)/p-1
SMILES:C1CCc2c(CC1)nc1ccccc1c2C(=O)[O-]
Synonyms:- 6H-cyclohepta[b]quinoline-11-carboxylic acid, 7,8,9,10-tetrahydro-, ion(1-)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7,8,9,10-Tetrahydro-6H-cyclohepta[b]quinoline-11-carboxylic acid
CAS:Molecular weight:241.2899932861328
