CAS 71016-95-0

Cyclopentanecarboxylic anhydride

Description:

Cyclopentanecarboxylic anhydride, with the CAS number 71016-95-0, is a cyclic anhydride derived from cyclopentanecarboxylic acid. It features a five-membered ring structure that includes an anhydride functional group, which is characterized by the presence of two carbonyl groups (C=O) connected by an oxygen atom. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its reactivity, particularly in undergoing hydrolysis to form the corresponding carboxylic acid upon exposure to moisture. Cyclopentanecarboxylic anhydride can be utilized in various chemical synthesis processes, including the production of polymers and as a reagent in organic chemistry. Its properties make it valuable in applications such as the manufacture of resins and as an intermediate in the synthesis of other chemical compounds. Safety precautions should be observed when handling this substance, as it may cause irritation to the skin and eyes, and proper storage conditions are essential to maintain its stability.

Formula: C₁₂H₁₈O₃

InChI: InChI=1/C12H18O3/c13-11(9-5-1-2-6-9)15-12(14)10-7-3-4-8-10/h9-10H,1-8H2

SMILES: C1CCC(C1)C(=O)OC(=O)C1CCCC1