
CAS 71022-76-9
:19-Chloro-3,6,9,12,15-pentaoxa-21-azabicyclo[15.3.1]heneicosa-1(21),17,19-triene-2,16-dione
Description:
19-Chloro-3,6,9,12,15-pentaoxa-21-azabicyclo[15.3.1]heneicosa-1(21),17,19-triene-2,16-dione, with CAS number 71022-76-9, is a complex organic compound characterized by its unique bicyclic structure and multiple functional groups. The presence of five ether linkages (indicated by the "pentaoxa" prefix) contributes to its potential solubility in polar solvents, while the azabicyclic framework suggests the presence of nitrogen within the ring system, which may influence its reactivity and biological activity. The chlorinated position may enhance its stability or alter its interaction with biological targets. The compound's dione functionality indicates the presence of two carbonyl groups, which can participate in various chemical reactions, including nucleophilic addition and condensation. Overall, this compound's intricate structure and functional groups suggest potential applications in medicinal chemistry, materials science, or as a synthetic intermediate, although specific biological or chemical properties would require empirical investigation.
Formula:C15H18ClNO7
InChI:InChI=1S/C15H18ClNO7/c16-11-9-12-14(18)23-7-5-21-3-1-20-2-4-22-6-8-24-15(19)13(10-11)17-12/h9-10H,1-8H2
InChI key:InChIKey=MHAHJUDEUMYAQJ-UHFFFAOYSA-N
SMILES:O=C1C=2N=C(C=C(Cl)C2)C(=O)OCCOCCOCCOCCO1
Synonyms:- 19-Chloro-3,6,9,12,15-pentaoxa-21-azabicyclo[15.3.1]heneicosa-1(21),17,19-triene-2,16-dione
- 3,6,9,12,15-Pentaoxa-21-azabicyclo[15.3.1]heneicosa-1(21),17,19-triene-2,16-dione, 19-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,6,9,12,15-Pentaoxa-21-azabicyclo[15.3.1]heneicosa-1(21),17,19-triene-2,16-dione, 19-chloro-
CAS:Formula:C15H18ClNO7Molecular weight:359.7589
