CAS 71022-86-1

3′-Methoxy[1,1′-biphenyl]-4-ol

Description:

3′-Methoxy[1,1′-biphenyl]-4-ol, with the CAS number 71022-86-1, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a methoxy group (-OCH₃) attached to one of the phenyl rings and a hydroxyl group (-OH) at the para position relative to the methoxy group on the other ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The methoxy group can enhance the compound's lipophilicity, while the hydroxyl group can participate in hydrogen bonding, influencing solubility and interaction with biological systems. Additionally, the compound may exhibit antioxidant properties due to the presence of the hydroxyl group. Its structural characteristics suggest potential utility in the synthesis of more complex organic molecules or as a building block in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₂O₂

InChI: InChI=1S/C13H12O2/c1-15-13-4-2-3-11(9-13)10-5-7-12(14)8-6-10/h2-9,14H,1H3

InChI key: InChIKey=GZZXHAGDCYWOOA-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=CC1)C2=CC=C(O)C=C2

Synonyms:

• 3′-Methoxy[1,1′-biphenyl]-4-ol
• [1,1′-Biphenyl]-4-ol, 3′-methoxy-