CAS 71025-65-5
:1,1-difluoro-3-phenyl-propan-2-amine
Description:
1,1-Difluoro-3-phenyl-propan-2-amine, with the CAS number 71025-65-5, is an organic compound characterized by the presence of a propan-2-amine backbone substituted with two fluorine atoms and a phenyl group. This compound features a chiral center at the second carbon, which can lead to the existence of enantiomers. The difluoromethyl group contributes to its unique chemical reactivity and potential biological activity, as fluorinated compounds often exhibit altered pharmacokinetic properties compared to their non-fluorinated counterparts. The phenyl group enhances the lipophilicity of the molecule, potentially influencing its interaction with biological targets. In terms of physical properties, it is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The compound may be of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules. However, detailed studies on its toxicity, stability, and reactivity would be necessary to fully understand its characteristics and applications.
Formula:C9H11F2N
InChI:InChI=1/C9H11F2N/c10-9(11)8(12)6-7-4-2-1-3-5-7/h1-5,8-9H,6,12H2
SMILES:c1ccc(cc1)CC(C(F)F)N
Synonyms:- 1,1-Difluoro-3-phenylpropan-2-amine
- 1-Benzyl-2,2-difluoro-ethylamine
- Benzeneethanamine, Α-(Difluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.