CAS 710292-49-2

2-[(4-fluorobenzyl)sulfanyl]aniline

Description:

2-[(4-Fluorobenzyl)sulfanyl]aniline, identified by its CAS number 710292-49-2, is an organic compound characterized by the presence of both an aniline and a sulfanyl group. This compound features a fluorobenzyl moiety, where a fluorine atom is substituted on a benzene ring, enhancing its electronic properties and potentially influencing its reactivity and biological activity. The sulfanyl group (-S-) introduces a sulfur atom, which can participate in various chemical reactions, including nucleophilic substitutions and redox processes. The compound is likely to exhibit moderate solubility in organic solvents due to its aromatic structure, while its polar amine group may impart some degree of solubility in polar solvents. Additionally, the presence of the fluorine atom can affect the compound's lipophilicity and overall pharmacokinetic properties, making it of interest in medicinal chemistry. Overall, 2-[(4-fluorobenzyl)sulfanyl]aniline is a versatile compound with potential applications in pharmaceuticals and materials science, warranting further investigation into its properties and uses.

Formula: C₁₃H₁₂FNS

InChI: InChI=1/C13H12FNS/c14-11-7-5-10(6-8-11)9-16-13-4-2-1-3-12(13)15/h1-8H,9,15H2

SMILES: c1ccc(c(c1)N)SCc1ccc(cc1)F