CAS 710323-21-0
:5-(thiophen-3-yl)pyrazin-2-amine
Description:
5-(Thiophen-3-yl)pyrazin-2-amine is an organic compound characterized by its unique structure, which includes a pyrazine ring and a thiophene substituent. The presence of the pyrazine ring, a six-membered aromatic heterocycle containing two nitrogen atoms, contributes to its potential biological activity and chemical reactivity. The thiophene moiety, a five-membered ring containing sulfur, enhances the compound's electronic properties and can influence its interactions with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its functional groups suggest potential applications in pharmaceuticals, particularly in the development of new drugs, as compounds with similar structures have been explored for their antimicrobial, anti-inflammatory, and anticancer properties. Additionally, the presence of amine functionality can facilitate further chemical modifications, making it a versatile building block in organic synthesis. Overall, 5-(thiophen-3-yl)pyrazin-2-amine is of interest in both synthetic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C8H7N3S
InChI:InChI=1/C8H7N3S/c9-8-4-10-7(3-11-8)6-1-2-12-5-6/h1-5H,(H2,9,11)
Synonyms:- 5-(3-Thienyl)pyrazin-2-amine
- 2-pyrazinamine, 5-(3-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

