
CAS 710323-22-1
:5-(3-Furanyl)-2-pyrazinamine
Description:
5-(3-Furanyl)-2-pyrazinamine is an organic compound characterized by its unique structure, which includes a pyrazinamine core and a furanyl substituent. The presence of the pyrazine ring contributes to its aromatic properties, while the furanyl group enhances its reactivity and potential for forming hydrogen bonds due to the presence of oxygen in the furan ring. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents, depending on its functional groups. It may also display interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. The compound's reactivity can be influenced by the electron-donating and electron-withdrawing effects of the furan and pyrazine rings, respectively. Additionally, its potential applications could span various fields, including pharmaceuticals and agrochemicals, due to its structural features that may interact with biological targets. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c9-8-4-10-7(3-11-8)6-1-2-12-5-6/h1-5H,(H2,9,11)
InChI key:InChIKey=CKRJWKZZINIQQT-UHFFFAOYSA-N
SMILES:NC=1N=CC(=NC1)C=2C=COC2
Synonyms:- 2-Pyrazinamine, 5-(3-furanyl)-
- Pyrazinamine, 5-(3-furanyl)-
- 5-(3-Furanyl)-2-pyrazinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.